 Product categoryFriends links |
|
 Click on the image to check the artwork |
|
| product: |
view count: 156DMB |
| unit price: |
Negotiable |
| min amount: |
|
| amount: |
|
| period for delivery: |
Consignment Deadline days |
| Expiry date: |
Long Effective |
| last update: |
2017-09-21 10:26 |
| |
 |
|
DMB
| Category: |
Intermediates |
|
| CAS NO: |
119-93-7 |
| EC NO: |
204-358-0 |
| Molecular Formula: |
C14H16N2
|
| Molecular Weight: |
212.2902 |
| Specification: |
|
| InChI: |
InChI=1/C14H16N2/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12/h3-8H,15-16H2,1-2H3 |
| Synonyms: |
C.I. 37230;C.I. Azoic Diazo Component 113;Orthotolidine;o-Tolidine;Azoic diazo component 113;DMB;Fast Dark Blue Base R;1'-biphenyl)-4,4'-diamine,3,3'-dimethyl-;(1'-Biphenyl)-4,4'-diamine-3,3'-dimethyl-;(1,1'-biphenyl)-4,4'-diamine-3,3'-dimethyl-;(1'-biphenyl]-4,4'-diamine,3,3'-dimethyl-;[2-Tolidin;2-Tolidina;2-Tolidine;3,3'-dimethyl-4,4'-biphenyldiamine;3,3'-dimethyl-[1,1'-biphenyl]-4,4'- diamine;3,3'-dimethyl-[1,1'-biphenyl]-4,4'-diamine;3,3'-Dimethylbenzidine;3,3'-dimethyl-4,4'-diaminobiphenyl;o-Tolidine(3,3'-Dimethylbenzidine);3,3'-Dimethyl-[1,1'-biphenyl]-4,4'-Diamine(O-Tolidine); |
| Molecular Structure: |
 |
|
